C15H13F3N6O2S — CID 113051523
3,5-dimethyl-N-[6-(2,3,4-trifluoroanilino)pyridazin-3-yl]-1H-pyrazole-4-sulfonamide (PubChem CID 113051523) has the molecular formula C15H13F3N6O2S and a molecular weight of 398.37 g/mol. Its IUPAC name is 3,5-dimethyl-N-[6-(2,3,4-trifluoroanilino)pyridazin-3-yl]-1H-pyrazole-4-sulfonamide.
| Compound Name | 3,5-dimethyl-N-[6-(2,3,4-trifluoroanilino)pyridazin-3-yl]-1H-pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 113051523 |
| Molecular Formula | C15H13F3N6O2S |
| Molecular Weight | 398.37 g/mol |
| Exact Mass | 398.08 |
| IUPAC Name | 3,5-dimethyl-N-[6-(2,3,4-trifluoroanilino)pyridazin-3-yl]-1H-pyrazole-4-sulfonamide |
| SMILES | Cc1n[nH]c(C)c1S(=O)(=O)Nc1ccc(Nc2ccc(F)c(F)c2F)nn1 |
| InChI | InChI=1S/C15H13F3N6O2S/c1-7-15(8(2)21-20-7)27(25,26)24-12-6-5-11(22-23-12)19-10-4-3-9(16)13(17)14(10)18/h3-6H,1-2H3,(H,19,22)(H,20,21)(H,23,24) |
| InChIKey | FCHLKMYPAQQJQV-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 112.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.37 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|