C11H6F16 — CID 11305288
(Z)-1,1,1,5,5,5-hexafluoro-3-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,4-dimethyl-4-(trifluoromethyl)pent-2-ene (PubChem CID 11305288) has the molecular formula C11H6F16 and a molecular weight of 442.14 g/mol. Its IUPAC name is (Z)-1,1,1,5,5,5-hexafluoro-3-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,4-dimethyl-4-(trifluoromethyl)pent-2-ene.
| Compound Name | (Z)-1,1,1,5,5,5-hexafluoro-3-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,4-dimethyl-4-(trifluoromethyl)pent-2-ene |
|---|---|
| PubChem CID | 11305288 |
| Molecular Formula | C11H6F16 |
| Molecular Weight | 442.14 g/mol |
| Exact Mass | 442.02 |
| IUPAC Name | (Z)-1,1,1,5,5,5-hexafluoro-3-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,4-dimethyl-4-(trifluoromethyl)pent-2-ene |
| SMILES | C/C(=C(\C(C)(C(F)(F)F)C(F)(F)F)C(F)(C(F)(F)F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C11H6F16/c1-3(7(13,14)15)4(5(2,8(16,17)18)9(19,20)21)6(12,10(22,23)24)11(25,26)27/h1-2H3/b4-3- |
| InChIKey | IGASNYLLDGOPAB-ARJAWSKDSA-N |
| XLogP | 6.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.14 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|