C19H33N3O2 — CID 113053087
N-[2-(cyclohexen-1-yl)ethyl]-N-[2-(cyclohexylcarbamoylamino)ethyl]acetamide (PubChem CID 113053087) has the molecular formula C19H33N3O2 and a molecular weight of 335.49 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-N-[2-(cyclohexylcarbamoylamino)ethyl]acetamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-N-[2-(cyclohexylcarbamoylamino)ethyl]acetamide |
|---|---|
| PubChem CID | 113053087 |
| Molecular Formula | C19H33N3O2 |
| Molecular Weight | 335.49 g/mol |
| Exact Mass | 335.26 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-N-[2-(cyclohexylcarbamoylamino)ethyl]acetamide |
| SMILES | CC(=O)N(CCNC(=O)NC1CCCCC1)CCC1=CCCCC1 |
| InChI | InChI=1S/C19H33N3O2/c1-16(23)22(14-12-17-8-4-2-5-9-17)15-13-20-19(24)21-18-10-6-3-7-11-18/h8,18H,2-7,9-15H2,1H3,(H2,20,21,24) |
| InChIKey | UGXZISFTURDSQE-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.49 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|