C18H23NO12 — CID 11305357
[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[(3S)-3-hydroxy-2,5-dioxopyrrolidin-1-yl]oxan-2-yl]methyl acetate (PubChem CID 11305357) has the molecular formula C18H23NO12 and a molecular weight of 445.38 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[(3S)-3-hydroxy-2,5-dioxopyrrolidin-1-yl]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[(3S)-3-hydroxy-2,5-dioxopyrrolidin-1-yl]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 11305357 |
| Molecular Formula | C18H23NO12 |
| Molecular Weight | 445.38 g/mol |
| Exact Mass | 445.12 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[(3S)-3-hydroxy-2,5-dioxopyrrolidin-1-yl]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](N2C(=O)C[C@H](O)C2=O)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C18H23NO12/c1-7(20)27-6-12-14(28-8(2)21)15(29-9(3)22)16(30-10(4)23)18(31-12)19-13(25)5-11(24)17(19)26/h11-12,14-16,18,24H,5-6H2,1-4H3/t11-,12+,14+,15-,16+,18+/m0/s1 |
| InChIKey | JUCPCXWTYJQUMY-JRYUUTJWSA-N |
| XLogP | -1.81 |
| TPSA | 172.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.38 |
| LogP ≤ 5 | -1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|