C20H20F4N2O2 — CID 113055767
N-[2-[acetyl-[2-(4-fluorophenyl)ethyl]amino]ethyl]-4-(trifluoromethyl)benzamide (PubChem CID 113055767) has the molecular formula C20H20F4N2O2 and a molecular weight of 396.38 g/mol. Its IUPAC name is N-[2-[acetyl-[2-(4-fluorophenyl)ethyl]amino]ethyl]-4-(trifluoromethyl)benzamide.
| Compound Name | N-[2-[acetyl-[2-(4-fluorophenyl)ethyl]amino]ethyl]-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 113055767 |
| Molecular Formula | C20H20F4N2O2 |
| Molecular Weight | 396.38 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | N-[2-[acetyl-[2-(4-fluorophenyl)ethyl]amino]ethyl]-4-(trifluoromethyl)benzamide |
| SMILES | CC(=O)N(CCNC(=O)c1ccc(C(F)(F)F)cc1)CCc1ccc(F)cc1 |
| InChI | InChI=1S/C20H20F4N2O2/c1-14(27)26(12-10-15-2-8-18(21)9-3-15)13-11-25-19(28)16-4-6-17(7-5-16)20(22,23)24/h2-9H,10-13H2,1H3,(H,25,28) |
| InChIKey | UQEXAWABSROYGI-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.38 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |