C16H30N2O2 — CID 113056688
N-[2-[acetyl(cycloheptyl)amino]ethyl]-2,2-dimethylpropanamide (PubChem CID 113056688) has the molecular formula C16H30N2O2 and a molecular weight of 282.43 g/mol. Its IUPAC name is N-[2-[acetyl(cycloheptyl)amino]ethyl]-2,2-dimethylpropanamide.
| Compound Name | N-[2-[acetyl(cycloheptyl)amino]ethyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 113056688 |
| Molecular Formula | C16H30N2O2 |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.23 |
| IUPAC Name | N-[2-[acetyl(cycloheptyl)amino]ethyl]-2,2-dimethylpropanamide |
| SMILES | CC(=O)N(CCNC(=O)C(C)(C)C)C1CCCCCC1 |
| InChI | InChI=1S/C16H30N2O2/c1-13(19)18(14-9-7-5-6-8-10-14)12-11-17-15(20)16(2,3)4/h14H,5-12H2,1-4H3,(H,17,20) |
| InChIKey | JQGMGMXRENQNJV-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |