C28H48O3Si — CID 11305727
[(1R,2S)-1-[3,5-dimethoxy-4-[(4S)-oct-1-en-4-yl]phenyl]-2-methylpent-4-enoxy]-triethylsilane (PubChem CID 11305727) has the molecular formula C28H48O3Si and a molecular weight of 460.78 g/mol. Its IUPAC name is [(1R,2S)-1-[3,5-dimethoxy-4-[(4S)-oct-1-en-4-yl]phenyl]-2-methylpent-4-enoxy]-triethylsilane.
| Compound Name | [(1R,2S)-1-[3,5-dimethoxy-4-[(4S)-oct-1-en-4-yl]phenyl]-2-methylpent-4-enoxy]-triethylsilane |
|---|---|
| PubChem CID | 11305727 |
| Molecular Formula | C28H48O3Si |
| Molecular Weight | 460.78 g/mol |
| Exact Mass | 460.34 |
| IUPAC Name | [(1R,2S)-1-[3,5-dimethoxy-4-[(4S)-oct-1-en-4-yl]phenyl]-2-methylpent-4-enoxy]-triethylsilane |
| SMILES | C=CC[C@H](CCCC)c1c(OC)cc([C@H](O[Si](CC)(CC)CC)[C@@H](C)CC=C)cc1OC |
| InChI | InChI=1S/C28H48O3Si/c1-10-16-19-23(18-12-3)27-25(29-8)20-24(21-26(27)30-9)28(22(7)17-11-2)31-32(13-4,14-5)15-6/h11-12,20-23,28H,2-3,10,13-19H2,1,4-9H3/t22-,23+,28+/m0/s1 |
| InChIKey | KKHKMFXKVBYEIO-SXDGJLEOSA-N |
| XLogP | 8.83 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.78 |
| LogP ≤ 5 | 8.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|