C21H26N2O4 — CID 113057678
N-[2-(N-acetyl-2,4-dimethylanilino)ethyl]-3,5-dimethoxybenzamide (PubChem CID 113057678) has the molecular formula C21H26N2O4 and a molecular weight of 370.45 g/mol. Its IUPAC name is N-[2-(N-acetyl-2,4-dimethylanilino)ethyl]-3,5-dimethoxybenzamide.
| Compound Name | N-[2-(N-acetyl-2,4-dimethylanilino)ethyl]-3,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 113057678 |
| Molecular Formula | C21H26N2O4 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | N-[2-(N-acetyl-2,4-dimethylanilino)ethyl]-3,5-dimethoxybenzamide |
| SMILES | COc1cc(OC)cc(C(=O)NCCN(C(C)=O)c2ccc(C)cc2C)c1 |
| InChI | InChI=1S/C21H26N2O4/c1-14-6-7-20(15(2)10-14)23(16(3)24)9-8-22-21(25)17-11-18(26-4)13-19(12-17)27-5/h6-7,10-13H,8-9H2,1-5H3,(H,22,25) |
| InChIKey | ZXMCQAKPJZDUTA-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |