C21H26N2O2 — CID 113057996
N-[2-(N-acetyl-3,5-dimethylanilino)ethyl]-3,4-dimethylbenzamide (PubChem CID 113057996) has the molecular formula C21H26N2O2 and a molecular weight of 338.45 g/mol. Its IUPAC name is N-[2-(N-acetyl-3,5-dimethylanilino)ethyl]-3,4-dimethylbenzamide.
| Compound Name | N-[2-(N-acetyl-3,5-dimethylanilino)ethyl]-3,4-dimethylbenzamide |
|---|---|
| PubChem CID | 113057996 |
| Molecular Formula | C21H26N2O2 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.20 |
| IUPAC Name | N-[2-(N-acetyl-3,5-dimethylanilino)ethyl]-3,4-dimethylbenzamide |
| SMILES | CC(=O)N(CCNC(=O)c1ccc(C)c(C)c1)c1cc(C)cc(C)c1 |
| InChI | InChI=1S/C21H26N2O2/c1-14-10-15(2)12-20(11-14)23(18(5)24)9-8-22-21(25)19-7-6-16(3)17(4)13-19/h6-7,10-13H,8-9H2,1-5H3,(H,22,25) |
| InChIKey | IEBDTJXCOJMHED-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |