C18H33ClN12O — CID 11305902
3,5-diamino-6-chloro-N-[N'-[4-[4-[3-(diaminomethylideneamino)propyl]piperazin-1-yl]butyl]carbamimidoyl]pyrazine-2-carboxamide (PubChem CID 11305902) has the molecular formula C18H33ClN12O and a molecular weight of 469.00 g/mol. Its IUPAC name is 3,5-diamino-6-chloro-N-[N'-[4-[4-[3-(diaminomethylideneamino)propyl]piperazin-1-yl]butyl]carbamimidoyl]pyrazine-2-carboxamide.
| Compound Name | 3,5-diamino-6-chloro-N-[N'-[4-[4-[3-(diaminomethylideneamino)propyl]piperazin-1-yl]butyl]carbamimidoyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 11305902 |
| Molecular Formula | C18H33ClN12O |
| Molecular Weight | 469.00 g/mol |
| Exact Mass | 468.26 |
| IUPAC Name | 3,5-diamino-6-chloro-N-[N'-[4-[4-[3-(diaminomethylideneamino)propyl]piperazin-1-yl]butyl]carbamimidoyl]pyrazine-2-carboxamide |
| SMILES | NC(N)=NCCCN1CCN(CCCC/N=C(\N)NC(=O)c2nc(Cl)c(N)nc2N)CC1 |
| InChI | InChI=1S/C18H33ClN12O/c19-13-15(21)28-14(20)12(27-13)16(32)29-18(24)26-4-1-2-6-30-8-10-31(11-9-30)7-3-5-25-17(22)23/h1-11H2,(H4,20,21,28)(H4,22,23,25)(H3,24,26,29,32) |
| InChIKey | AWSBHMHIHXZVTG-UHFFFAOYSA-N |
| XLogP | -1.60 |
| TPSA | 216.18 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.00 |
| LogP ≤ 5 | -1.60 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|