C21H25FN2O2 — CID 113059185
N-[2-(N-acetyl-2-fluoroanilino)ethyl]-4-tert-butylbenzamide (PubChem CID 113059185) has the molecular formula C21H25FN2O2 and a molecular weight of 356.44 g/mol. Its IUPAC name is N-[2-(N-acetyl-2-fluoroanilino)ethyl]-4-tert-butylbenzamide.
| Compound Name | N-[2-(N-acetyl-2-fluoroanilino)ethyl]-4-tert-butylbenzamide |
|---|---|
| PubChem CID | 113059185 |
| Molecular Formula | C21H25FN2O2 |
| Molecular Weight | 356.44 g/mol |
| Exact Mass | 356.19 |
| IUPAC Name | N-[2-(N-acetyl-2-fluoroanilino)ethyl]-4-tert-butylbenzamide |
| SMILES | CC(=O)N(CCNC(=O)c1ccc(C(C)(C)C)cc1)c1ccccc1F |
| InChI | InChI=1S/C21H25FN2O2/c1-15(25)24(19-8-6-5-7-18(19)22)14-13-23-20(26)16-9-11-17(12-10-16)21(2,3)4/h5-12H,13-14H2,1-4H3,(H,23,26) |
| InChIKey | UYFSALMIMIKDFR-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.44 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |