C17H15F3N2O2 — CID 113059331
N-[2-(N-acetyl-4-fluoroanilino)ethyl]-3,4-difluorobenzamide (PubChem CID 113059331) has the molecular formula C17H15F3N2O2 and a molecular weight of 336.31 g/mol. Its IUPAC name is N-[2-(N-acetyl-4-fluoroanilino)ethyl]-3,4-difluorobenzamide.
| Compound Name | N-[2-(N-acetyl-4-fluoroanilino)ethyl]-3,4-difluorobenzamide |
|---|---|
| PubChem CID | 113059331 |
| Molecular Formula | C17H15F3N2O2 |
| Molecular Weight | 336.31 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | N-[2-(N-acetyl-4-fluoroanilino)ethyl]-3,4-difluorobenzamide |
| SMILES | CC(=O)N(CCNC(=O)c1ccc(F)c(F)c1)c1ccc(F)cc1 |
| InChI | InChI=1S/C17H15F3N2O2/c1-11(23)22(14-5-3-13(18)4-6-14)9-8-21-17(24)12-2-7-15(19)16(20)10-12/h2-7,10H,8-9H2,1H3,(H,21,24) |
| InChIKey | GWBKCCGQYMPMJB-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.31 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |