C26H50O5Si — CID 11305939
(E,4R,6S,7S,8S)-7-[tert-butyl(dimethyl)silyl]oxy-1-[(4S,5R)-5-ethyl-2,2,4-trimethyl-1,3-dioxolan-4-yl]-9-hydroxy-4,6,8-trimethylnon-1-en-3-one (PubChem CID 11305939) has the molecular formula C26H50O5Si and a molecular weight of 470.77 g/mol. Its IUPAC name is (E,4R,6S,7S,8S)-7-[tert-butyl(dimethyl)silyl]oxy-1-[(4S,5R)-5-ethyl-2,2,4-trimethyl-1,3-dioxolan-4-yl]-9-hydroxy-4,6,8-trimethylnon-1-en-3-one.
| Compound Name | (E,4R,6S,7S,8S)-7-[tert-butyl(dimethyl)silyl]oxy-1-[(4S,5R)-5-ethyl-2,2,4-trimethyl-1,3-dioxolan-4-yl]-9-hydroxy-4,6,8-trimethylnon-1-en-3-one |
|---|---|
| PubChem CID | 11305939 |
| Molecular Formula | C26H50O5Si |
| Molecular Weight | 470.77 g/mol |
| Exact Mass | 470.34 |
| IUPAC Name | (E,4R,6S,7S,8S)-7-[tert-butyl(dimethyl)silyl]oxy-1-[(4S,5R)-5-ethyl-2,2,4-trimethyl-1,3-dioxolan-4-yl]-9-hydroxy-4,6,8-trimethylnon-1-en-3-one |
| SMILES | CC[C@H]1OC(C)(C)O[C@@]1(C)/C=C/C(=O)[C@H](C)C[C@H](C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)CO |
| InChI | InChI=1S/C26H50O5Si/c1-13-22-26(10,31-25(8,9)29-22)15-14-21(28)18(2)16-19(3)23(20(4)17-27)30-32(11,12)24(5,6)7/h14-15,18-20,22-23,27H,13,16-17H2,1-12H3/b15-14+/t18-,19+,20+,22-,23+,26+/m1/s1 |
| InChIKey | BDEQLCZFPMHIAE-TZIRTYEQSA-N |
| XLogP | 6.11 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.77 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|