C23H22F2N4O3S — CID 11305974
N,N-bis[(4-fluorophenyl)methyl]-N'-[1-[(2S,5R)-2-(hydroxymethyl)-1,3-oxathiolan-5-yl]-2-oxopyrimidin-4-yl]methanimidamide (PubChem CID 11305974) has the molecular formula C23H22F2N4O3S and a molecular weight of 472.52 g/mol. Its IUPAC name is N,N-bis[(4-fluorophenyl)methyl]-N'-[1-[(2S,5R)-2-(hydroxymethyl)-1,3-oxathiolan-5-yl]-2-oxopyrimidin-4-yl]methanimidamide.
| Compound Name | N,N-bis[(4-fluorophenyl)methyl]-N'-[1-[(2S,5R)-2-(hydroxymethyl)-1,3-oxathiolan-5-yl]-2-oxopyrimidin-4-yl]methanimidamide |
|---|---|
| PubChem CID | 11305974 |
| Molecular Formula | C23H22F2N4O3S |
| Molecular Weight | 472.52 g/mol |
| Exact Mass | 472.14 |
| IUPAC Name | N,N-bis[(4-fluorophenyl)methyl]-N'-[1-[(2S,5R)-2-(hydroxymethyl)-1,3-oxathiolan-5-yl]-2-oxopyrimidin-4-yl]methanimidamide |
| SMILES | O=c1nc(/N=C/N(Cc2ccc(F)cc2)Cc2ccc(F)cc2)ccn1[C@H]1CS[C@@H](CO)O1 |
| InChI | InChI=1S/C23H22F2N4O3S/c24-18-5-1-16(2-6-18)11-28(12-17-3-7-19(25)8-4-17)15-26-20-9-10-29(23(31)27-20)21-14-33-22(13-30)32-21/h1-10,15,21-22,30H,11-14H2/b26-15+/t21-,22+/m1/s1 |
| InChIKey | OZUXSKQGKSVZIE-YCTNYIMWSA-N |
| XLogP | 3.46 |
| TPSA | 79.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.52 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|