C14H19ClN2O4 — CID 113060315
ethyl N-[2-(N-acetyl-5-chloro-2-methoxyanilino)ethyl]carbamate (PubChem CID 113060315) has the molecular formula C14H19ClN2O4 and a molecular weight of 314.77 g/mol. Its IUPAC name is ethyl N-[2-(N-acetyl-5-chloro-2-methoxyanilino)ethyl]carbamate.
| Compound Name | ethyl N-[2-(N-acetyl-5-chloro-2-methoxyanilino)ethyl]carbamate |
|---|---|
| PubChem CID | 113060315 |
| Molecular Formula | C14H19ClN2O4 |
| Molecular Weight | 314.77 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | ethyl N-[2-(N-acetyl-5-chloro-2-methoxyanilino)ethyl]carbamate |
| SMILES | CCOC(=O)NCCN(C(C)=O)c1cc(Cl)ccc1OC |
| InChI | InChI=1S/C14H19ClN2O4/c1-4-21-14(19)16-7-8-17(10(2)18)12-9-11(15)5-6-13(12)20-3/h5-6,9H,4,7-8H2,1-3H3,(H,16,19) |
| InChIKey | FJNZWSAPBUMDLD-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.77 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |