C29H28N4O3 — CID 11306162
2-[4-[3-[4-[5-(4,5-dihydro-1H-imidazol-2-yl)-1-benzofuran-2-yl]phenoxy]propoxy]phenyl]-4,5-dihydro-1H-imidazole (PubChem CID 11306162) has the molecular formula C29H28N4O3 and a molecular weight of 480.57 g/mol. Its IUPAC name is 2-[4-[3-[4-[5-(4,5-dihydro-1H-imidazol-2-yl)-1-benzofuran-2-yl]phenoxy]propoxy]phenyl]-4,5-dihydro-1H-imidazole.
| Compound Name | 2-[4-[3-[4-[5-(4,5-dihydro-1H-imidazol-2-yl)-1-benzofuran-2-yl]phenoxy]propoxy]phenyl]-4,5-dihydro-1H-imidazole |
|---|---|
| PubChem CID | 11306162 |
| Molecular Formula | C29H28N4O3 |
| Molecular Weight | 480.57 g/mol |
| Exact Mass | 480.22 |
| IUPAC Name | 2-[4-[3-[4-[5-(4,5-dihydro-1H-imidazol-2-yl)-1-benzofuran-2-yl]phenoxy]propoxy]phenyl]-4,5-dihydro-1H-imidazole |
| SMILES | c1cc(C2=NCCN2)ccc1OCCCOc1ccc(-c2cc3cc(C4=NCCN4)ccc3o2)cc1 |
| InChI | InChI=1S/C29H28N4O3/c1(17-35-25-9-4-21(5-10-25)28-30-12-13-31-28)16-34-24-7-2-20(3-8-24)27-19-23-18-22(6-11-26(23)36-27)29-32-14-15-33-29/h2-11,18-19H,1,12-17H2,(H,30,31)(H,32,33) |
| InChIKey | AJRRSVVDXXGFSU-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 80.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.57 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|