C25H25ClN4O2S — CID 11306174
5-(4-chlorophenyl)-4-phenyl-N'-(2,4,6-trimethylphenyl)sulfonyl-3,4-dihydropyrazole-2-carboximidamide (PubChem CID 11306174) has the molecular formula C25H25ClN4O2S and a molecular weight of 481.02 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-4-phenyl-N'-(2,4,6-trimethylphenyl)sulfonyl-3,4-dihydropyrazole-2-carboximidamide.
| Compound Name | 5-(4-chlorophenyl)-4-phenyl-N'-(2,4,6-trimethylphenyl)sulfonyl-3,4-dihydropyrazole-2-carboximidamide |
|---|---|
| PubChem CID | 11306174 |
| Molecular Formula | C25H25ClN4O2S |
| Molecular Weight | 481.02 g/mol |
| Exact Mass | 480.14 |
| IUPAC Name | 5-(4-chlorophenyl)-4-phenyl-N'-(2,4,6-trimethylphenyl)sulfonyl-3,4-dihydropyrazole-2-carboximidamide |
| SMILES | Cc1cc(C)c(S(=O)(=O)/N=C(\N)N2CC(c3ccccc3)C(c3ccc(Cl)cc3)=N2)c(C)c1 |
| InChI | InChI=1S/C25H25ClN4O2S/c1-16-13-17(2)24(18(3)14-16)33(31,32)29-25(27)30-15-22(19-7-5-4-6-8-19)23(28-30)20-9-11-21(26)12-10-20/h4-14,22H,15H2,1-3H3,(H2,27,29) |
| InChIKey | RBDSMVUZBCAAEN-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 88.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.02 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|