C20H24FN3O2 — CID 113062203
N-[2-[N-acetyl-4-(dimethylamino)anilino]ethyl]-2-(3-fluorophenyl)acetamide (PubChem CID 113062203) has the molecular formula C20H24FN3O2 and a molecular weight of 357.43 g/mol. Its IUPAC name is N-[2-[N-acetyl-4-(dimethylamino)anilino]ethyl]-2-(3-fluorophenyl)acetamide.
| Compound Name | N-[2-[N-acetyl-4-(dimethylamino)anilino]ethyl]-2-(3-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 113062203 |
| Molecular Formula | C20H24FN3O2 |
| Molecular Weight | 357.43 g/mol |
| Exact Mass | 357.19 |
| IUPAC Name | N-[2-[N-acetyl-4-(dimethylamino)anilino]ethyl]-2-(3-fluorophenyl)acetamide |
| SMILES | CC(=O)N(CCNC(=O)Cc1cccc(F)c1)c1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C20H24FN3O2/c1-15(25)24(19-9-7-18(8-10-19)23(2)3)12-11-22-20(26)14-16-5-4-6-17(21)13-16/h4-10,13H,11-12,14H2,1-3H3,(H,22,26) |
| InChIKey | OOKXHKASDVIVDN-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.43 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|