C17H25BrN2O2 — CID 113062870
N-[2-(N-acetyl-4-bromo-2-methylanilino)ethyl]-2-ethylbutanamide (PubChem CID 113062870) has the molecular formula C17H25BrN2O2 and a molecular weight of 369.30 g/mol. Its IUPAC name is N-[2-(N-acetyl-4-bromo-2-methylanilino)ethyl]-2-ethylbutanamide.
| Compound Name | N-[2-(N-acetyl-4-bromo-2-methylanilino)ethyl]-2-ethylbutanamide |
|---|---|
| PubChem CID | 113062870 |
| Molecular Formula | C17H25BrN2O2 |
| Molecular Weight | 369.30 g/mol |
| Exact Mass | 368.11 |
| IUPAC Name | N-[2-(N-acetyl-4-bromo-2-methylanilino)ethyl]-2-ethylbutanamide |
| SMILES | CCC(CC)C(=O)NCCN(C(C)=O)c1ccc(Br)cc1C |
| InChI | InChI=1S/C17H25BrN2O2/c1-5-14(6-2)17(22)19-9-10-20(13(4)21)16-8-7-15(18)11-12(16)3/h7-8,11,14H,5-6,9-10H2,1-4H3,(H,19,22) |
| InChIKey | ULFNGNZUVCHZIM-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.30 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |