C13H16ClF3N2O3S — CID 113063486
N-[4-chloro-3-(trifluoromethyl)phenyl]-N-[2-(ethylsulfonylamino)ethyl]acetamide (PubChem CID 113063486) has the molecular formula C13H16ClF3N2O3S and a molecular weight of 372.80 g/mol. Its IUPAC name is N-[4-chloro-3-(trifluoromethyl)phenyl]-N-[2-(ethylsulfonylamino)ethyl]acetamide.
| Compound Name | N-[4-chloro-3-(trifluoromethyl)phenyl]-N-[2-(ethylsulfonylamino)ethyl]acetamide |
|---|---|
| PubChem CID | 113063486 |
| Molecular Formula | C13H16ClF3N2O3S |
| Molecular Weight | 372.80 g/mol |
| Exact Mass | 372.05 |
| IUPAC Name | N-[4-chloro-3-(trifluoromethyl)phenyl]-N-[2-(ethylsulfonylamino)ethyl]acetamide |
| SMILES | CCS(=O)(=O)NCCN(C(C)=O)c1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H16ClF3N2O3S/c1-3-23(21,22)18-6-7-19(9(2)20)10-4-5-12(14)11(8-10)13(15,16)17/h4-5,8,18H,3,6-7H2,1-2H3 |
| InChIKey | INKORXSYYJMRHG-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.80 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |