C21H23N3O5 — CID 113064117
N-[2-(N-acetyl-2-cyanoanilino)ethyl]-3,4,5-trimethoxybenzamide (PubChem CID 113064117) has the molecular formula C21H23N3O5 and a molecular weight of 397.43 g/mol. Its IUPAC name is N-[2-(N-acetyl-2-cyanoanilino)ethyl]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[2-(N-acetyl-2-cyanoanilino)ethyl]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 113064117 |
| Molecular Formula | C21H23N3O5 |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.16 |
| IUPAC Name | N-[2-(N-acetyl-2-cyanoanilino)ethyl]-3,4,5-trimethoxybenzamide |
| SMILES | COc1cc(C(=O)NCCN(C(C)=O)c2ccccc2C#N)cc(OC)c1OC |
| InChI | InChI=1S/C21H23N3O5/c1-14(25)24(17-8-6-5-7-15(17)13-22)10-9-23-21(26)16-11-18(27-2)20(29-4)19(12-16)28-3/h5-8,11-12H,9-10H2,1-4H3,(H,23,26) |
| InChIKey | LMTXPENPHYWWHC-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 100.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |