About CID 11306426
CID 11306426 (PubChem CID 11306426) has the molecular formula C5H7Cl9N2OP2
and a molecular weight of 492.15 g/mol.
Molecular Properties
| Compound Name | CID 11306426 |
| PubChem CID | 11306426 |
| Molecular Formula | C5H7Cl9N2OP2 |
| Molecular Weight | 492.15 g/mol |
| Exact Mass | 487.72 |
| IUPAC Name | — |
| SMILES | CN1C(=O)N(C)[P+](Cl)(Cl)C=C1Cl.Cl[P-](Cl)(Cl)(Cl)(Cl)Cl |
| InChI | InChI=1S/C5H7Cl3N2OP.Cl6P/c1-9-4(6)3-12(7,8)10(2)5(9)11;1-7(2,3,4,5)6/h3H,1-2H3;/q+1;-1 |
| InChIKey | IWRBIWBGXIJYFZ-UHFFFAOYSA-N |
| XLogP | 8.26 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 492.15 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze CID 11306426 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 11306426?
The IUPAC name of CID 11306426 (CID 11306426) is not available.
What is the SMILES notation for CID 11306426?
The canonical SMILES for CID 11306426 is CN1C(=O)N(C)[P+](Cl)(Cl)C=C1Cl.Cl[P-](Cl)(Cl)(Cl)(Cl)Cl.
What is the InChIKey of CID 11306426?
The InChIKey is IWRBIWBGXIJYFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7Cl3N2OP.Cl6P/c1-9-4(6)3-12(7,8)10(2)5(9)11;1-7(2,3,4,5)6/h3H,1-2H3;/q+1;-1.
What are the key properties of CID 11306426?
CID 11306426 has a molecular weight of 492.15 g/mol, XLogP of 8.26, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 11306426 is sourced from PubChem (CID 11306426), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).