C17H16ClF8N5O — CID 11306467
(3R)-3-amino-1-[3-(1,1,2,2,2-pentafluoroethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-4-(2,4,5-trifluorophenyl)butan-1-one;hydrochloride (PubChem CID 11306467) has the molecular formula C17H16ClF8N5O and a molecular weight of 493.79 g/mol. Its IUPAC name is (3R)-3-amino-1-[3-(1,1,2,2,2-pentafluoroethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-4-(2,4,5-trifluorophenyl)butan-1-one;hydrochloride.
| Compound Name | (3R)-3-amino-1-[3-(1,1,2,2,2-pentafluoroethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-4-(2,4,5-trifluorophenyl)butan-1-one;hydrochloride |
|---|---|
| PubChem CID | 11306467 |
| Molecular Formula | C17H16ClF8N5O |
| Molecular Weight | 493.79 g/mol |
| Exact Mass | 493.09 |
| IUPAC Name | (3R)-3-amino-1-[3-(1,1,2,2,2-pentafluoroethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-4-(2,4,5-trifluorophenyl)butan-1-one;hydrochloride |
| SMILES | Cl.N[C@@H](CC(=O)N1CCn2c(nnc2C(F)(F)C(F)(F)F)C1)Cc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C17H15F8N5O.ClH/c18-10-6-12(20)11(19)4-8(10)3-9(26)5-14(31)29-1-2-30-13(7-29)27-28-15(30)16(21,22)17(23,24)25;/h4,6,9H,1-3,5,7,26H2;1H/t9-;/m1./s1 |
| InChIKey | UIISQNZRIRZLDV-SBSPUUFOSA-N |
| XLogP | 3.07 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.79 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|