C18H25FN2O3S — CID 113065900
N-[2-[2-(cyclohexen-1-yl)ethyl-methylsulfonylamino]ethyl]-4-fluorobenzamide (PubChem CID 113065900) has the molecular formula C18H25FN2O3S and a molecular weight of 368.47 g/mol. Its IUPAC name is N-[2-[2-(cyclohexen-1-yl)ethyl-methylsulfonylamino]ethyl]-4-fluorobenzamide.
| Compound Name | N-[2-[2-(cyclohexen-1-yl)ethyl-methylsulfonylamino]ethyl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 113065900 |
| Molecular Formula | C18H25FN2O3S |
| Molecular Weight | 368.47 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | N-[2-[2-(cyclohexen-1-yl)ethyl-methylsulfonylamino]ethyl]-4-fluorobenzamide |
| SMILES | CS(=O)(=O)N(CCNC(=O)c1ccc(F)cc1)CCC1=CCCCC1 |
| InChI | InChI=1S/C18H25FN2O3S/c1-25(23,24)21(13-11-15-5-3-2-4-6-15)14-12-20-18(22)16-7-9-17(19)10-8-16/h5,7-10H,2-4,6,11-14H2,1H3,(H,20,22) |
| InChIKey | MHQPDFGSUDVHJZ-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.47 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|