C24H33NO3Sn — CID 11306599
dibutyltin;(2S)-2-[[(E)-(6-oxocyclohexa-2,4-dien-1-ylidene)methyl]amino]-3-phenylpropanoic acid (PubChem CID 11306599) has the molecular formula C24H33NO3Sn and a molecular weight of 502.24 g/mol. Its IUPAC name is dibutyltin;(2S)-2-[[(E)-(6-oxocyclohexa-2,4-dien-1-ylidene)methyl]amino]-3-phenylpropanoic acid.
| Compound Name | dibutyltin;(2S)-2-[[(E)-(6-oxocyclohexa-2,4-dien-1-ylidene)methyl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 11306599 |
| Molecular Formula | C24H33NO3Sn |
| Molecular Weight | 502.24 g/mol |
| Exact Mass | 503.15 |
| IUPAC Name | dibutyltin;(2S)-2-[[(E)-(6-oxocyclohexa-2,4-dien-1-ylidene)methyl]amino]-3-phenylpropanoic acid |
| SMILES | CCCC[Sn]CCCC.O=C1C=CC=C/C1=C\N[C@@H](Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C16H15NO3.2C4H9.Sn/c18-15-9-5-4-8-13(15)11-17-14(16(19)20)10-12-6-2-1-3-7-12;2*1-3-4-2;/h1-9,11,14,17H,10H2,(H,19,20);2*1,3-4H2,2H3;/b13-11+;;;/t14-;;;/m0.../s1 |
| InChIKey | FULBOYOAGBFAJG-BUPNBGHNSA-N |
| XLogP | 4.98 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.24 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|