C15H21FN2O3S — CID 113066986
N-[2-[(4-fluorophenyl)methyl-methylsulfonylamino]ethyl]cyclobutanecarboxamide (PubChem CID 113066986) has the molecular formula C15H21FN2O3S and a molecular weight of 328.41 g/mol. Its IUPAC name is N-[2-[(4-fluorophenyl)methyl-methylsulfonylamino]ethyl]cyclobutanecarboxamide.
| Compound Name | N-[2-[(4-fluorophenyl)methyl-methylsulfonylamino]ethyl]cyclobutanecarboxamide |
|---|---|
| PubChem CID | 113066986 |
| Molecular Formula | C15H21FN2O3S |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | N-[2-[(4-fluorophenyl)methyl-methylsulfonylamino]ethyl]cyclobutanecarboxamide |
| SMILES | CS(=O)(=O)N(CCNC(=O)C1CCC1)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C15H21FN2O3S/c1-22(20,21)18(11-12-5-7-14(16)8-6-12)10-9-17-15(19)13-3-2-4-13/h5-8,13H,2-4,9-11H2,1H3,(H,17,19) |
| InChIKey | LMGJVQHDYYVCGY-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |