C31H17N3O5 — CID 11306807
3-(3-oxobenzo[f]chromene-2-carbonyl)-1,5-diphenylpyrrolo[3,4-d]pyrazole-4,6-dione (PubChem CID 11306807) has the molecular formula C31H17N3O5 and a molecular weight of 511.49 g/mol. Its IUPAC name is 3-(3-oxobenzo[f]chromene-2-carbonyl)-1,5-diphenylpyrrolo[3,4-d]pyrazole-4,6-dione.
| Compound Name | 3-(3-oxobenzo[f]chromene-2-carbonyl)-1,5-diphenylpyrrolo[3,4-d]pyrazole-4,6-dione |
|---|---|
| PubChem CID | 11306807 |
| Molecular Formula | C31H17N3O5 |
| Molecular Weight | 511.49 g/mol |
| Exact Mass | 511.12 |
| IUPAC Name | 3-(3-oxobenzo[f]chromene-2-carbonyl)-1,5-diphenylpyrrolo[3,4-d]pyrazole-4,6-dione |
| SMILES | O=C(c1nn(-c2ccccc2)c2c1C(=O)N(c1ccccc1)C2=O)c1cc2c(ccc3ccccc32)oc1=O |
| InChI | InChI=1S/C31H17N3O5/c35-28(23-17-22-21-14-8-7-9-18(21)15-16-24(22)39-31(23)38)26-25-27(34(32-26)20-12-5-2-6-13-20)30(37)33(29(25)36)19-10-3-1-4-11-19/h1-17H |
| InChIKey | QOYDREFHNYISMY-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 102.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.49 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|