C17H28N2O5S — CID 113068223
3,4-dimethoxy-N-[2-[3-methylbutyl(methylsulfonyl)amino]ethyl]benzamide (PubChem CID 113068223) has the molecular formula C17H28N2O5S and a molecular weight of 372.49 g/mol. Its IUPAC name is 3,4-dimethoxy-N-[2-[3-methylbutyl(methylsulfonyl)amino]ethyl]benzamide.
| Compound Name | 3,4-dimethoxy-N-[2-[3-methylbutyl(methylsulfonyl)amino]ethyl]benzamide |
|---|---|
| PubChem CID | 113068223 |
| Molecular Formula | C17H28N2O5S |
| Molecular Weight | 372.49 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | 3,4-dimethoxy-N-[2-[3-methylbutyl(methylsulfonyl)amino]ethyl]benzamide |
| SMILES | COc1ccc(C(=O)NCCN(CCC(C)C)S(C)(=O)=O)cc1OC |
| InChI | InChI=1S/C17H28N2O5S/c1-13(2)8-10-19(25(5,21)22)11-9-18-17(20)14-6-7-15(23-3)16(12-14)24-4/h6-7,12-13H,8-11H2,1-5H3,(H,18,20) |
| InChIKey | HTBWJVNXPJAPHK-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.49 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |