C28H32N4O6 — CID 11306939
(2R,4R)-1-N-(4-ethynylphenyl)-4-(2-methoxyethoxy)-2-N-[2-methyl-4-(3-oxomorpholin-4-yl)phenyl]pyrrolidine-1,2-dicarboxamide (PubChem CID 11306939) has the molecular formula C28H32N4O6 and a molecular weight of 520.59 g/mol. Its IUPAC name is (2R,4R)-1-N-(4-ethynylphenyl)-4-(2-methoxyethoxy)-2-N-[2-methyl-4-(3-oxomorpholin-4-yl)phenyl]pyrrolidine-1,2-dicarboxamide.
| Compound Name | (2R,4R)-1-N-(4-ethynylphenyl)-4-(2-methoxyethoxy)-2-N-[2-methyl-4-(3-oxomorpholin-4-yl)phenyl]pyrrolidine-1,2-dicarboxamide |
|---|---|
| PubChem CID | 11306939 |
| Molecular Formula | C28H32N4O6 |
| Molecular Weight | 520.59 g/mol |
| Exact Mass | 520.23 |
| IUPAC Name | (2R,4R)-1-N-(4-ethynylphenyl)-4-(2-methoxyethoxy)-2-N-[2-methyl-4-(3-oxomorpholin-4-yl)phenyl]pyrrolidine-1,2-dicarboxamide |
| SMILES | C#Cc1ccc(NC(=O)N2C[C@H](OCCOC)C[C@@H]2C(=O)Nc2ccc(N3CCOCC3=O)cc2C)cc1 |
| InChI | InChI=1S/C28H32N4O6/c1-4-20-5-7-21(8-6-20)29-28(35)32-17-23(38-14-13-36-3)16-25(32)27(34)30-24-10-9-22(15-19(24)2)31-11-12-37-18-26(31)33/h1,5-10,15,23,25H,11-14,16-18H2,2-3H3,(H,29,35)(H,30,34)/t23-,25-/m1/s1 |
| InChIKey | GOWLGWOJCLAZLZ-ILBGXUMGSA-N |
| XLogP | 2.62 |
| TPSA | 109.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.59 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|