C18H21FN2O5S — CID 113069746
N-[2-(4-fluoro-N-methylsulfonylanilino)ethyl]-3,5-dimethoxybenzamide (PubChem CID 113069746) has the molecular formula C18H21FN2O5S and a molecular weight of 396.44 g/mol. Its IUPAC name is N-[2-(4-fluoro-N-methylsulfonylanilino)ethyl]-3,5-dimethoxybenzamide.
| Compound Name | N-[2-(4-fluoro-N-methylsulfonylanilino)ethyl]-3,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 113069746 |
| Molecular Formula | C18H21FN2O5S |
| Molecular Weight | 396.44 g/mol |
| Exact Mass | 396.12 |
| IUPAC Name | N-[2-(4-fluoro-N-methylsulfonylanilino)ethyl]-3,5-dimethoxybenzamide |
| SMILES | COc1cc(OC)cc(C(=O)NCCN(c2ccc(F)cc2)S(C)(=O)=O)c1 |
| InChI | InChI=1S/C18H21FN2O5S/c1-25-16-10-13(11-17(12-16)26-2)18(22)20-8-9-21(27(3,23)24)15-6-4-14(19)5-7-15/h4-7,10-12H,8-9H2,1-3H3,(H,20,22) |
| InChIKey | ODQRVWUHRNEDPA-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.44 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |