C26H41NO8Si — CID 11306988
(3S,5R,6S)-7-[(4S)-4-benzyl-2-oxo-1,3-oxazolidin-3-yl]-5-methoxy-6-(methoxymethoxy)-7-oxo-3-triethylsilyloxyheptanal (PubChem CID 11306988) has the molecular formula C26H41NO8Si and a molecular weight of 523.70 g/mol. Its IUPAC name is (3S,5R,6S)-7-[(4S)-4-benzyl-2-oxo-1,3-oxazolidin-3-yl]-5-methoxy-6-(methoxymethoxy)-7-oxo-3-triethylsilyloxyheptanal.
| Compound Name | (3S,5R,6S)-7-[(4S)-4-benzyl-2-oxo-1,3-oxazolidin-3-yl]-5-methoxy-6-(methoxymethoxy)-7-oxo-3-triethylsilyloxyheptanal |
|---|---|
| PubChem CID | 11306988 |
| Molecular Formula | C26H41NO8Si |
| Molecular Weight | 523.70 g/mol |
| Exact Mass | 523.26 |
| IUPAC Name | (3S,5R,6S)-7-[(4S)-4-benzyl-2-oxo-1,3-oxazolidin-3-yl]-5-methoxy-6-(methoxymethoxy)-7-oxo-3-triethylsilyloxyheptanal |
| SMILES | CC[Si](CC)(CC)O[C@H](CC=O)C[C@@H](OC)[C@H](OCOC)C(=O)N1C(=O)OC[C@@H]1Cc1ccccc1 |
| InChI | InChI=1S/C26H41NO8Si/c1-6-36(7-2,8-3)35-22(14-15-28)17-23(32-5)24(34-19-31-4)25(29)27-21(18-33-26(27)30)16-20-12-10-9-11-13-20/h9-13,15,21-24H,6-8,14,16-19H2,1-5H3/t21-,22+,23+,24-/m0/s1 |
| InChIKey | YWLJRJSBQAQRNN-KEZOAJOQSA-N |
| XLogP | 3.95 |
| TPSA | 100.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.70 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|