C14H23ClN2O4S2 — CID 113070022
N-[2-(3-chloro-2-methyl-N-methylsulfonylanilino)ethyl]butane-1-sulfonamide (PubChem CID 113070022) has the molecular formula C14H23ClN2O4S2 and a molecular weight of 382.94 g/mol. Its IUPAC name is N-[2-(3-chloro-2-methyl-N-methylsulfonylanilino)ethyl]butane-1-sulfonamide.
| Compound Name | N-[2-(3-chloro-2-methyl-N-methylsulfonylanilino)ethyl]butane-1-sulfonamide |
|---|---|
| PubChem CID | 113070022 |
| Molecular Formula | C14H23ClN2O4S2 |
| Molecular Weight | 382.94 g/mol |
| Exact Mass | 382.08 |
| IUPAC Name | N-[2-(3-chloro-2-methyl-N-methylsulfonylanilino)ethyl]butane-1-sulfonamide |
| SMILES | CCCCS(=O)(=O)NCCN(c1cccc(Cl)c1C)S(C)(=O)=O |
| InChI | InChI=1S/C14H23ClN2O4S2/c1-4-5-11-23(20,21)16-9-10-17(22(3,18)19)14-8-6-7-13(15)12(14)2/h6-8,16H,4-5,9-11H2,1-3H3 |
| InChIKey | PXSYEFINDOHMMU-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.94 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |