C24H26Cl2N6O4 — CID 11307128
2-acetamido-4-[2-[[2-[4-[(3,5-dichloro-1,2,4-triazol-1-yl)methyl]phenyl]benzoyl]amino]ethylamino]butanoic acid (PubChem CID 11307128) has the molecular formula C24H26Cl2N6O4 and a molecular weight of 533.42 g/mol. Its IUPAC name is 2-acetamido-4-[2-[[2-[4-[(3,5-dichloro-1,2,4-triazol-1-yl)methyl]phenyl]benzoyl]amino]ethylamino]butanoic acid.
| Compound Name | 2-acetamido-4-[2-[[2-[4-[(3,5-dichloro-1,2,4-triazol-1-yl)methyl]phenyl]benzoyl]amino]ethylamino]butanoic acid |
|---|---|
| PubChem CID | 11307128 |
| Molecular Formula | C24H26Cl2N6O4 |
| Molecular Weight | 533.42 g/mol |
| Exact Mass | 532.14 |
| IUPAC Name | 2-acetamido-4-[2-[[2-[4-[(3,5-dichloro-1,2,4-triazol-1-yl)methyl]phenyl]benzoyl]amino]ethylamino]butanoic acid |
| SMILES | CC(=O)NC(CCNCCNC(=O)c1ccccc1-c1ccc(Cn2nc(Cl)nc2Cl)cc1)C(=O)O |
| InChI | InChI=1S/C24H26Cl2N6O4/c1-15(33)29-20(22(35)36)10-11-27-12-13-28-21(34)19-5-3-2-4-18(19)17-8-6-16(7-9-17)14-32-24(26)30-23(25)31-32/h2-9,20,27H,10-14H2,1H3,(H,28,34)(H,29,33)(H,35,36) |
| InChIKey | UWFDREJVYIPGHB-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 138.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.42 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|