C20H27N3O3S — CID 113071294
N-[2-[4-(dimethylamino)-N-methylsulfonylanilino]ethyl]-3,4-dimethylbenzamide (PubChem CID 113071294) has the molecular formula C20H27N3O3S and a molecular weight of 389.52 g/mol. Its IUPAC name is N-[2-[4-(dimethylamino)-N-methylsulfonylanilino]ethyl]-3,4-dimethylbenzamide.
| Compound Name | N-[2-[4-(dimethylamino)-N-methylsulfonylanilino]ethyl]-3,4-dimethylbenzamide |
|---|---|
| PubChem CID | 113071294 |
| Molecular Formula | C20H27N3O3S |
| Molecular Weight | 389.52 g/mol |
| Exact Mass | 389.18 |
| IUPAC Name | N-[2-[4-(dimethylamino)-N-methylsulfonylanilino]ethyl]-3,4-dimethylbenzamide |
| SMILES | Cc1ccc(C(=O)NCCN(c2ccc(N(C)C)cc2)S(C)(=O)=O)cc1C |
| InChI | InChI=1S/C20H27N3O3S/c1-15-6-7-17(14-16(15)2)20(24)21-12-13-23(27(5,25)26)19-10-8-18(9-11-19)22(3)4/h6-11,14H,12-13H2,1-5H3,(H,21,24) |
| InChIKey | ODDILZULFQRCLB-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.52 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|