About tributyl-[(E)-3-[3,5-dimethoxy-2-(methoxymethoxy)-4-methylphenyl]prop-2-enyl]stannane
tributyl-[(E)-3-[3,5-dimethoxy-2-(methoxymethoxy)-4-methylphenyl]prop-2-enyl]stannane (PubChem CID 11307247) has the molecular formula C26H46O4Sn
and a molecular weight of 541.36 g/mol. Its IUPAC name is tributyl-[(E)-3-[3,5-dimethoxy-2-(methoxymethoxy)-4-methylphenyl]prop-2-enyl]stannane.
Molecular Properties
| Compound Name | tributyl-[(E)-3-[3,5-dimethoxy-2-(methoxymethoxy)-4-methylphenyl]prop-2-enyl]stannane |
| PubChem CID | 11307247 |
| Molecular Formula | C26H46O4Sn |
| Molecular Weight | 541.36 g/mol |
| Exact Mass | 542.24 |
| IUPAC Name | tributyl-[(E)-3-[3,5-dimethoxy-2-(methoxymethoxy)-4-methylphenyl]prop-2-enyl]stannane |
| SMILES | CCCC[Sn](C/C=C/c1cc(OC)c(C)c(OC)c1OCOC)(CCCC)CCCC |
| InChI | InChI=1S/C14H19O4.3C4H9.Sn/c1-6-7-11-8-12(16-4)10(2)13(17-5)14(11)18-9-15-3;3*1-3-4-2;/h6-8H,1,9H2,2-5H3;3*1,3-4H2,2H3;/b7-6+;;;; |
| InChIKey | NWZYCXWIGGHKMN-MNPOOLNOSA-N |
| XLogP | 7.86 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 541.36 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze tributyl-[(E)-3-[3,5-dimethoxy-2-(methoxymethoxy)-4-methylphenyl]prop-2-enyl]stannane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tributyl-[(E)-3-[3,5-dimethoxy-2-(methoxymethoxy)-4-methylphenyl]prop-2-enyl]stannane?
The IUPAC name of tributyl-[(E)-3-[3,5-dimethoxy-2-(methoxymethoxy)-4-methylphenyl]prop-2-enyl]stannane (CID 11307247) is tributyl-[(E)-3-[3,5-dimethoxy-2-(methoxymethoxy)-4-methylphenyl]prop-2-enyl]stannane.
What is the SMILES notation for tributyl-[(E)-3-[3,5-dimethoxy-2-(methoxymethoxy)-4-methylphenyl]prop-2-enyl]stannane?
The canonical SMILES for tributyl-[(E)-3-[3,5-dimethoxy-2-(methoxymethoxy)-4-methylphenyl]prop-2-enyl]stannane is CCCC[Sn](C/C=C/c1cc(OC)c(C)c(OC)c1OCOC)(CCCC)CCCC.
What is the InChIKey of tributyl-[(E)-3-[3,5-dimethoxy-2-(methoxymethoxy)-4-methylphenyl]prop-2-enyl]stannane?
The InChIKey is NWZYCXWIGGHKMN-MNPOOLNOSA-N. The full InChI is InChI=1S/C14H19O4.3C4H9.Sn/c1-6-7-11-8-12(16-4)10(2)13(17-5)14(11)18-9-15-3;3*1-3-4-2;/h6-8H,1,9H2,2-5H3;3*1,3-4H2,2H3;/b7-6+;;;;.
What are the key properties of tributyl-[(E)-3-[3,5-dimethoxy-2-(methoxymethoxy)-4-methylphenyl]prop-2-enyl]stannane?
tributyl-[(E)-3-[3,5-dimethoxy-2-(methoxymethoxy)-4-methylphenyl]prop-2-enyl]stannane has a molecular weight of 541.36 g/mol, XLogP of 7.86, 17 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tributyl-[(E)-3-[3,5-dimethoxy-2-(methoxymethoxy)-4-methylphenyl]prop-2-enyl]stannane is sourced from PubChem (CID 11307247), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).