C29H43NO7Si — CID 11307308
2-trimethylsilylethyl (2S,3R,5R,6R,8S)-3-benzoyloxy-6,8-dimethyl-2-[(2S,4R)-4-methyl-6-oxooxan-2-yl]-1-oxa-10-azaspiro[4.5]decane-10-carboxylate (PubChem CID 11307308) has the molecular formula C29H43NO7Si and a molecular weight of 545.75 g/mol. Its IUPAC name is 2-trimethylsilylethyl (2S,3R,5R,6R,8S)-3-benzoyloxy-6,8-dimethyl-2-[(2S,4R)-4-methyl-6-oxooxan-2-yl]-1-oxa-10-azaspiro[4.5]decane-10-carboxylate.
| Compound Name | 2-trimethylsilylethyl (2S,3R,5R,6R,8S)-3-benzoyloxy-6,8-dimethyl-2-[(2S,4R)-4-methyl-6-oxooxan-2-yl]-1-oxa-10-azaspiro[4.5]decane-10-carboxylate |
|---|---|
| PubChem CID | 11307308 |
| Molecular Formula | C29H43NO7Si |
| Molecular Weight | 545.75 g/mol |
| Exact Mass | 545.28 |
| IUPAC Name | 2-trimethylsilylethyl (2S,3R,5R,6R,8S)-3-benzoyloxy-6,8-dimethyl-2-[(2S,4R)-4-methyl-6-oxooxan-2-yl]-1-oxa-10-azaspiro[4.5]decane-10-carboxylate |
| SMILES | C[C@H]1CC(=O)O[C@H]([C@@H]2O[C@]3(C[C@H]2OC(=O)c2ccccc2)[C@H](C)C[C@H](C)CN3C(=O)OCC[Si](C)(C)C)C1 |
| InChI | InChI=1S/C29H43NO7Si/c1-19-15-23(35-25(31)16-19)26-24(36-27(32)22-10-8-7-9-11-22)17-29(37-26)21(3)14-20(2)18-30(29)28(33)34-12-13-38(4,5)6/h7-11,19-21,23-24,26H,12-18H2,1-6H3/t19-,20+,21-,23+,24-,26+,29-/m1/s1 |
| InChIKey | XFICCBIYDVCXOU-WLULYSPVSA-N |
| XLogP | 5.49 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.75 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|