C13H26N2O2 — CID 113073330
1-[4-(3-methoxypropyl)piperazin-1-yl]-2,2-dimethylpropan-1-one (PubChem CID 113073330) has the molecular formula C13H26N2O2 and a molecular weight of 242.36 g/mol. Its IUPAC name is 1-[4-(3-methoxypropyl)piperazin-1-yl]-2,2-dimethylpropan-1-one.
| Compound Name | 1-[4-(3-methoxypropyl)piperazin-1-yl]-2,2-dimethylpropan-1-one |
|---|---|
| PubChem CID | 113073330 |
| Molecular Formula | C13H26N2O2 |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.20 |
| IUPAC Name | 1-[4-(3-methoxypropyl)piperazin-1-yl]-2,2-dimethylpropan-1-one |
| SMILES | COCCCN1CCN(C(=O)C(C)(C)C)CC1 |
| InChI | InChI=1S/C13H26N2O2/c1-13(2,3)12(16)15-9-7-14(8-10-15)6-5-11-17-4/h5-11H2,1-4H3 |
| InChIKey | LUPGABRCQDYJEF-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|