C29H29ClN4O5 — CID 11307362
2-[(3-chlorophenyl)methylamino]-N-(2-phenoxyethyl)-4-(3,4,5-trimethoxyphenyl)pyrimidine-5-carboxamide (PubChem CID 11307362) has the molecular formula C29H29ClN4O5 and a molecular weight of 549.03 g/mol. Its IUPAC name is 2-[(3-chlorophenyl)methylamino]-N-(2-phenoxyethyl)-4-(3,4,5-trimethoxyphenyl)pyrimidine-5-carboxamide.
| Compound Name | 2-[(3-chlorophenyl)methylamino]-N-(2-phenoxyethyl)-4-(3,4,5-trimethoxyphenyl)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 11307362 |
| Molecular Formula | C29H29ClN4O5 |
| Molecular Weight | 549.03 g/mol |
| Exact Mass | 548.18 |
| IUPAC Name | 2-[(3-chlorophenyl)methylamino]-N-(2-phenoxyethyl)-4-(3,4,5-trimethoxyphenyl)pyrimidine-5-carboxamide |
| SMILES | COc1cc(-c2nc(NCc3cccc(Cl)c3)ncc2C(=O)NCCOc2ccccc2)cc(OC)c1OC |
| InChI | InChI=1S/C29H29ClN4O5/c1-36-24-15-20(16-25(37-2)27(24)38-3)26-23(28(35)31-12-13-39-22-10-5-4-6-11-22)18-33-29(34-26)32-17-19-8-7-9-21(30)14-19/h4-11,14-16,18H,12-13,17H2,1-3H3,(H,31,35)(H,32,33,34) |
| InChIKey | PPGJXQJJPCTCCH-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 103.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.03 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|