C32H46O8 — CID 11307489
(10E,14E,16E)-6'-ethyl-21,24-dihydroxy-22-(hydroxymethyl)-5',11,13-trimethylspiro[3,7,19-trioxatetracyclo[15.6.1.14,8.020,24]pentacosa-10,14,16,22-tetraene-6,2'-oxane]-2-one (PubChem CID 11307489) has the molecular formula C32H46O8 and a molecular weight of 558.71 g/mol. Its IUPAC name is (10E,14E,16E)-6'-ethyl-21,24-dihydroxy-22-(hydroxymethyl)-5',11,13-trimethylspiro[3,7,19-trioxatetracyclo[15.6.1.14,8.020,24]pentacosa-10,14,16,22-tetraene-6,2'-oxane]-2-one.
| Compound Name | (10E,14E,16E)-6'-ethyl-21,24-dihydroxy-22-(hydroxymethyl)-5',11,13-trimethylspiro[3,7,19-trioxatetracyclo[15.6.1.14,8.020,24]pentacosa-10,14,16,22-tetraene-6,2'-oxane]-2-one |
|---|---|
| PubChem CID | 11307489 |
| Molecular Formula | C32H46O8 |
| Molecular Weight | 558.71 g/mol |
| Exact Mass | 558.32 |
| IUPAC Name | (10E,14E,16E)-6'-ethyl-21,24-dihydroxy-22-(hydroxymethyl)-5',11,13-trimethylspiro[3,7,19-trioxatetracyclo[15.6.1.14,8.020,24]pentacosa-10,14,16,22-tetraene-6,2'-oxane]-2-one |
| SMILES | CCC1OC2(CCC1C)CC1CC(C/C=C(\C)CC(C)/C=C/C=C3\COC4C(O)C(CO)=CC(C(=O)O1)C34O)O2 |
| InChI | InChI=1S/C32H46O8/c1-5-27-21(4)11-12-31(40-27)16-25-15-24(39-31)10-9-20(3)13-19(2)7-6-8-23-18-37-29-28(34)22(17-33)14-26(30(35)38-25)32(23,29)36/h6-9,14,19,21,24-29,33-34,36H,5,10-13,15-18H2,1-4H3/b7-6+,20-9+,23-8+ |
| InChIKey | UITYNHBZSXTYGH-VHYGWWPPSA-N |
| XLogP | 3.90 |
| TPSA | 114.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.71 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|