C27H53ClOSiSn — CID 11307699
[(4S,5E)-7-chloro-2-(tributylstannylmethyl)octa-1,5,7-trien-4-yl]oxy-triethylsilane (PubChem CID 11307699) has the molecular formula C27H53ClOSiSn and a molecular weight of 575.97 g/mol. Its IUPAC name is [(4S,5E)-7-chloro-2-(tributylstannylmethyl)octa-1,5,7-trien-4-yl]oxy-triethylsilane.
| Compound Name | [(4S,5E)-7-chloro-2-(tributylstannylmethyl)octa-1,5,7-trien-4-yl]oxy-triethylsilane |
|---|---|
| PubChem CID | 11307699 |
| Molecular Formula | C27H53ClOSiSn |
| Molecular Weight | 575.97 g/mol |
| Exact Mass | 576.26 |
| IUPAC Name | [(4S,5E)-7-chloro-2-(tributylstannylmethyl)octa-1,5,7-trien-4-yl]oxy-triethylsilane |
| SMILES | C=C(Cl)/C=C/[C@H](CC(=C)C[Sn](CCCC)(CCCC)CCCC)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C15H26ClOSi.3C4H9.Sn/c1-7-18(8-2,9-3)17-15(12-13(4)5)11-10-14(6)16;3*1-3-4-2;/h10-11,15H,4-9,12H2,1-3H3;3*1,3-4H2,2H3;/b11-10+;;;;/t15-;;;;/m1..../s1 |
| InChIKey | NISHLZBMTMOTFG-HDCGZBPBSA-N |
| XLogP | 10.48 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.97 |
| LogP ≤ 5 | 10.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|