C18H19ClN2O4S — CID 113078610
methyl 4-[4-(3-chlorophenyl)sulfonylpiperazin-1-yl]benzoate (PubChem CID 113078610) has the molecular formula C18H19ClN2O4S and a molecular weight of 394.88 g/mol. Its IUPAC name is methyl 4-[4-(3-chlorophenyl)sulfonylpiperazin-1-yl]benzoate.
| Compound Name | methyl 4-[4-(3-chlorophenyl)sulfonylpiperazin-1-yl]benzoate |
|---|---|
| PubChem CID | 113078610 |
| Molecular Formula | C18H19ClN2O4S |
| Molecular Weight | 394.88 g/mol |
| Exact Mass | 394.08 |
| IUPAC Name | methyl 4-[4-(3-chlorophenyl)sulfonylpiperazin-1-yl]benzoate |
| SMILES | COC(=O)c1ccc(N2CCN(S(=O)(=O)c3cccc(Cl)c3)CC2)cc1 |
| InChI | InChI=1S/C18H19ClN2O4S/c1-25-18(22)14-5-7-16(8-6-14)20-9-11-21(12-10-20)26(23,24)17-4-2-3-15(19)13-17/h2-8,13H,9-12H2,1H3 |
| InChIKey | NOXRFSZITDXNGE-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.88 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |