C28H35F2N11O2 — CID 11307879
3-[4-[[4,6-bis[(3R,5S)-3,5-diaminopiperidin-1-yl]-1,3,5-triazin-2-yl]amino]phenyl]-N-(3,4-difluorophenyl)-3-oxopropanamide (PubChem CID 11307879) has the molecular formula C28H35F2N11O2 and a molecular weight of 595.66 g/mol. Its IUPAC name is 3-[4-[[4,6-bis[(3R,5S)-3,5-diaminopiperidin-1-yl]-1,3,5-triazin-2-yl]amino]phenyl]-N-(3,4-difluorophenyl)-3-oxopropanamide.
| Compound Name | 3-[4-[[4,6-bis[(3R,5S)-3,5-diaminopiperidin-1-yl]-1,3,5-triazin-2-yl]amino]phenyl]-N-(3,4-difluorophenyl)-3-oxopropanamide |
|---|---|
| PubChem CID | 11307879 |
| Molecular Formula | C28H35F2N11O2 |
| Molecular Weight | 595.66 g/mol |
| Exact Mass | 595.29 |
| IUPAC Name | 3-[4-[[4,6-bis[(3R,5S)-3,5-diaminopiperidin-1-yl]-1,3,5-triazin-2-yl]amino]phenyl]-N-(3,4-difluorophenyl)-3-oxopropanamide |
| SMILES | N[C@@H]1C[C@H](N)CN(c2nc(Nc3ccc(C(=O)CC(=O)Nc4ccc(F)c(F)c4)cc3)nc(N3C[C@H](N)C[C@H](N)C3)n2)C1 |
| InChI | InChI=1S/C28H35F2N11O2/c29-22-6-5-21(9-23(22)30)35-25(43)10-24(42)15-1-3-20(4-2-15)36-26-37-27(40-11-16(31)7-17(32)12-40)39-28(38-26)41-13-18(33)8-19(34)14-41/h1-6,9,16-19H,7-8,10-14,31-34H2,(H,35,43)(H,36,37,38,39)/t16-,17+,18-,19+ |
| InChIKey | MILRGWVIKVAETI-QGFMHUBQSA-N |
| XLogP | 0.83 |
| TPSA | 207.43 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.66 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|