C18H18Cl2N2O2 — CID 113080416
[4-(2,6-dichlorophenyl)piperazin-1-yl]-(4-methoxyphenyl)methanone (PubChem CID 113080416) has the molecular formula C18H18Cl2N2O2 and a molecular weight of 365.26 g/mol. Its IUPAC name is [4-(2,6-dichlorophenyl)piperazin-1-yl]-(4-methoxyphenyl)methanone.
| Compound Name | [4-(2,6-dichlorophenyl)piperazin-1-yl]-(4-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 113080416 |
| Molecular Formula | C18H18Cl2N2O2 |
| Molecular Weight | 365.26 g/mol |
| Exact Mass | 364.07 |
| IUPAC Name | [4-(2,6-dichlorophenyl)piperazin-1-yl]-(4-methoxyphenyl)methanone |
| SMILES | COc1ccc(C(=O)N2CCN(c3c(Cl)cccc3Cl)CC2)cc1 |
| InChI | InChI=1S/C18H18Cl2N2O2/c1-24-14-7-5-13(6-8-14)18(23)22-11-9-21(10-12-22)17-15(19)3-2-4-16(17)20/h2-8H,9-12H2,1H3 |
| InChIKey | QQZXTKLOKWTWQQ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.26 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |