C37H42N6O3 — CID 11308054
(2S,4R)-N,4-dibenzyl-1-[(2S)-5-(diaminomethylideneamino)-2-[(2-naphthalen-1-ylacetyl)amino]pentanoyl]pyrrolidine-2-carboxamide (PubChem CID 11308054) has the molecular formula C37H42N6O3 and a molecular weight of 618.78 g/mol. Its IUPAC name is (2S,4R)-N,4-dibenzyl-1-[(2S)-5-(diaminomethylideneamino)-2-[(2-naphthalen-1-ylacetyl)amino]pentanoyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S,4R)-N,4-dibenzyl-1-[(2S)-5-(diaminomethylideneamino)-2-[(2-naphthalen-1-ylacetyl)amino]pentanoyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 11308054 |
| Molecular Formula | C37H42N6O3 |
| Molecular Weight | 618.78 g/mol |
| Exact Mass | 618.33 |
| IUPAC Name | (2S,4R)-N,4-dibenzyl-1-[(2S)-5-(diaminomethylideneamino)-2-[(2-naphthalen-1-ylacetyl)amino]pentanoyl]pyrrolidine-2-carboxamide |
| SMILES | NC(N)=NCCC[C@H](NC(=O)Cc1cccc2ccccc12)C(=O)N1C[C@H](Cc2ccccc2)C[C@H]1C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C37H42N6O3/c38-37(39)40-20-10-19-32(42-34(44)23-30-17-9-16-29-15-7-8-18-31(29)30)36(46)43-25-28(21-26-11-3-1-4-12-26)22-33(43)35(45)41-24-27-13-5-2-6-14-27/h1-9,11-18,28,32-33H,10,19-25H2,(H,41,45)(H,42,44)(H4,38,39,40)/t28-,32+,33+/m1/s1 |
| InChIKey | GVPVGDSXVWSVRJ-IDYPCJJGSA-N |
| XLogP | 3.70 |
| TPSA | 142.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.78 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|