About 2-(2-amino-3,5-dibromo-6-propylsulfanylphenyl)-4,6-dibromo-3-nitroaniline
2-(2-amino-3,5-dibromo-6-propylsulfanylphenyl)-4,6-dibromo-3-nitroaniline (PubChem CID 11308055) has the molecular formula C15H13Br4N3O2S
and a molecular weight of 618.97 g/mol. Its IUPAC name is 2-(2-amino-3,5-dibromo-6-propylsulfanylphenyl)-4,6-dibromo-3-nitroaniline.
Molecular Properties
| Compound Name | 2-(2-amino-3,5-dibromo-6-propylsulfanylphenyl)-4,6-dibromo-3-nitroaniline |
| PubChem CID | 11308055 |
| Molecular Formula | C15H13Br4N3O2S |
| Molecular Weight | 618.97 g/mol |
| Exact Mass | 614.75 |
| IUPAC Name | 2-(2-amino-3,5-dibromo-6-propylsulfanylphenyl)-4,6-dibromo-3-nitroaniline |
| SMILES | CCCSc1c(Br)cc(Br)c(N)c1-c1c(N)c(Br)cc(Br)c1[N+](=O)[O-] |
| InChI | InChI=1S/C15H13Br4N3O2S/c1-2-3-25-15-9(19)5-7(17)13(21)11(15)10-12(20)6(16)4-8(18)14(10)22(23)24/h4-5H,2-3,20-21H2,1H3 |
| InChIKey | FTXFSPMCHGINGY-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 95.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 618.97 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-amino-3,5-dibromo-6-propylsulfanylphenyl)-4,6-dibromo-3-nitroaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-amino-3,5-dibromo-6-propylsulfanylphenyl)-4,6-dibromo-3-nitroaniline?
The IUPAC name of 2-(2-amino-3,5-dibromo-6-propylsulfanylphenyl)-4,6-dibromo-3-nitroaniline (CID 11308055) is 2-(2-amino-3,5-dibromo-6-propylsulfanylphenyl)-4,6-dibromo-3-nitroaniline.
What is the SMILES notation for 2-(2-amino-3,5-dibromo-6-propylsulfanylphenyl)-4,6-dibromo-3-nitroaniline?
The canonical SMILES for 2-(2-amino-3,5-dibromo-6-propylsulfanylphenyl)-4,6-dibromo-3-nitroaniline is CCCSc1c(Br)cc(Br)c(N)c1-c1c(N)c(Br)cc(Br)c1[N+](=O)[O-].
What is the InChIKey of 2-(2-amino-3,5-dibromo-6-propylsulfanylphenyl)-4,6-dibromo-3-nitroaniline?
The InChIKey is FTXFSPMCHGINGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13Br4N3O2S/c1-2-3-25-15-9(19)5-7(17)13(21)11(15)10-12(20)6(16)4-8(18)14(10)22(23)24/h4-5H,2-3,20-21H2,1H3.
What are the key properties of 2-(2-amino-3,5-dibromo-6-propylsulfanylphenyl)-4,6-dibromo-3-nitroaniline?
2-(2-amino-3,5-dibromo-6-propylsulfanylphenyl)-4,6-dibromo-3-nitroaniline has a molecular weight of 618.97 g/mol, XLogP of 6.98, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-amino-3,5-dibromo-6-propylsulfanylphenyl)-4,6-dibromo-3-nitroaniline is sourced from PubChem (CID 11308055), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).