C16H27N3O2S — CID 113080714
N,N-diethyl-3-methyl-4-(4-methylsulfonylpiperazin-1-yl)aniline (PubChem CID 113080714) has the molecular formula C16H27N3O2S and a molecular weight of 325.48 g/mol. Its IUPAC name is N,N-diethyl-3-methyl-4-(4-methylsulfonylpiperazin-1-yl)aniline.
| Compound Name | N,N-diethyl-3-methyl-4-(4-methylsulfonylpiperazin-1-yl)aniline |
|---|---|
| PubChem CID | 113080714 |
| Molecular Formula | C16H27N3O2S |
| Molecular Weight | 325.48 g/mol |
| Exact Mass | 325.18 |
| IUPAC Name | N,N-diethyl-3-methyl-4-(4-methylsulfonylpiperazin-1-yl)aniline |
| SMILES | CCN(CC)c1ccc(N2CCN(S(C)(=O)=O)CC2)c(C)c1 |
| InChI | InChI=1S/C16H27N3O2S/c1-5-17(6-2)15-7-8-16(14(3)13-15)18-9-11-19(12-10-18)22(4,20)21/h7-8,13H,5-6,9-12H2,1-4H3 |
| InChIKey | WILHRQPWTIMOEP-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.48 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|