C15H18N4O — CID 113081528
1-phenyl-3-(4,5,6,7-tetrahydro-1H-benzimidazol-2-ylmethyl)urea (PubChem CID 113081528) has the molecular formula C15H18N4O and a molecular weight of 270.34 g/mol. Its IUPAC name is 1-phenyl-3-(4,5,6,7-tetrahydro-1H-benzimidazol-2-ylmethyl)urea.
| Compound Name | 1-phenyl-3-(4,5,6,7-tetrahydro-1H-benzimidazol-2-ylmethyl)urea |
|---|---|
| PubChem CID | 113081528 |
| Molecular Formula | C15H18N4O |
| Molecular Weight | 270.34 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | 1-phenyl-3-(4,5,6,7-tetrahydro-1H-benzimidazol-2-ylmethyl)urea |
| SMILES | O=C(NCc1nc2c([nH]1)CCCC2)Nc1ccccc1 |
| InChI | InChI=1S/C15H18N4O/c20-15(17-11-6-2-1-3-7-11)16-10-14-18-12-8-4-5-9-13(12)19-14/h1-3,6-7H,4-5,8-10H2,(H,18,19)(H2,16,17,20) |
| InChIKey | CXFZWMKPOKDGLS-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.34 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |