C31H68O5Si4 — CID 11308153
triethyl-[(2R,3R,4S,5R)-6-methylidene-4,5-bis(triethylsilyloxy)-2-(triethylsilyloxymethyl)oxan-3-yl]oxysilane (PubChem CID 11308153) has the molecular formula C31H68O5Si4 and a molecular weight of 633.22 g/mol. Its IUPAC name is triethyl-[(2R,3R,4S,5R)-6-methylidene-4,5-bis(triethylsilyloxy)-2-(triethylsilyloxymethyl)oxan-3-yl]oxysilane.
| Compound Name | triethyl-[(2R,3R,4S,5R)-6-methylidene-4,5-bis(triethylsilyloxy)-2-(triethylsilyloxymethyl)oxan-3-yl]oxysilane |
|---|---|
| PubChem CID | 11308153 |
| Molecular Formula | C31H68O5Si4 |
| Molecular Weight | 633.22 g/mol |
| Exact Mass | 632.41 |
| IUPAC Name | triethyl-[(2R,3R,4S,5R)-6-methylidene-4,5-bis(triethylsilyloxy)-2-(triethylsilyloxymethyl)oxan-3-yl]oxysilane |
| SMILES | C=C1O[C@H](CO[Si](CC)(CC)CC)[C@@H](O[Si](CC)(CC)CC)[C@H](O[Si](CC)(CC)CC)[C@H]1O[Si](CC)(CC)CC |
| InChI | InChI=1S/C31H68O5Si4/c1-14-37(15-2,16-3)32-26-28-30(35-39(20-7,21-8)22-9)31(36-40(23-10,24-11)25-12)29(27(13)33-28)34-38(17-4,18-5)19-6/h28-31H,13-26H2,1-12H3/t28-,29+,30-,31-/m1/s1 |
| InChIKey | BVGVPKFIZJQXJY-YXOGWZJSSA-N |
| XLogP | 10.09 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.22 |
| LogP ≤ 5 | 10.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|