C29H42N6O8S — CID 11308160
2-amino-5-(diaminomethylideneamino)pentanoic acid;(2S)-2-ethoxy-3-[4-[3-(5-methylsulfonyloxyindol-1-yl)propylamino]phenyl]propanoic acid (PubChem CID 11308160) has the molecular formula C29H42N6O8S and a molecular weight of 634.76 g/mol. Its IUPAC name is 2-amino-5-(diaminomethylideneamino)pentanoic acid;(2S)-2-ethoxy-3-[4-[3-(5-methylsulfonyloxyindol-1-yl)propylamino]phenyl]propanoic acid.
| Compound Name | 2-amino-5-(diaminomethylideneamino)pentanoic acid;(2S)-2-ethoxy-3-[4-[3-(5-methylsulfonyloxyindol-1-yl)propylamino]phenyl]propanoic acid |
|---|---|
| PubChem CID | 11308160 |
| Molecular Formula | C29H42N6O8S |
| Molecular Weight | 634.76 g/mol |
| Exact Mass | 634.28 |
| IUPAC Name | 2-amino-5-(diaminomethylideneamino)pentanoic acid;(2S)-2-ethoxy-3-[4-[3-(5-methylsulfonyloxyindol-1-yl)propylamino]phenyl]propanoic acid |
| SMILES | CCO[C@@H](Cc1ccc(NCCCn2ccc3cc(OS(C)(=O)=O)ccc32)cc1)C(=O)O.NC(N)=NCCCC(N)C(=O)O |
| InChI | InChI=1S/C23H28N2O6S.C6H14N4O2/c1-3-30-22(23(26)27)15-17-5-7-19(8-6-17)24-12-4-13-25-14-11-18-16-20(9-10-21(18)25)31-32(2,28)29;7-4(5(11)12)2-1-3-10-6(8)9/h5-11,14,16,22,24H,3-4,12-13,15H2,1-2H3,(H,26,27);4H,1-3,7H2,(H,11,12)(H4,8,9,10)/t22-;/m0./s1 |
| InChIKey | DFWLHHWLPZBKKO-FTBISJDPSA-N |
| XLogP | 1.97 |
| TPSA | 234.58 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.76 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|