About (4S,5S)-4,5-dihydroxy-5-[tri(propan-2-yl)silyloxymethyl]cyclopent-2-en-1-one
(4S,5S)-4,5-dihydroxy-5-[tri(propan-2-yl)silyloxymethyl]cyclopent-2-en-1-one (PubChem CID 11308181) has the molecular formula C15H28O4Si
and a molecular weight of 300.47 g/mol. Its IUPAC name is (4S,5S)-4,5-dihydroxy-5-[tri(propan-2-yl)silyloxymethyl]cyclopent-2-en-1-one.
Molecular Properties
| Compound Name | (4S,5S)-4,5-dihydroxy-5-[tri(propan-2-yl)silyloxymethyl]cyclopent-2-en-1-one |
| PubChem CID | 11308181 |
| Molecular Formula | C15H28O4Si |
| Molecular Weight | 300.47 g/mol |
| Exact Mass | 300.18 |
| IUPAC Name | (4S,5S)-4,5-dihydroxy-5-[tri(propan-2-yl)silyloxymethyl]cyclopent-2-en-1-one |
| SMILES | CC(C)[Si](OC[C@@]1(O)C(=O)C=C[C@@H]1O)(C(C)C)C(C)C |
| InChI | InChI=1S/C15H28O4Si/c1-10(2)20(11(3)4,12(5)6)19-9-15(18)13(16)7-8-14(15)17/h7-8,10-13,16,18H,9H2,1-6H3/t13-,15-/m0/s1 |
| InChIKey | DJTANHVKXGAQHU-ZFWWWQNUSA-N |
| XLogP | 2.41 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.47 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (4S,5S)-4,5-dihydroxy-5-[tri(propan-2-yl)silyloxymethyl]cyclopent-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S,5S)-4,5-dihydroxy-5-[tri(propan-2-yl)silyloxymethyl]cyclopent-2-en-1-one?
The IUPAC name of (4S,5S)-4,5-dihydroxy-5-[tri(propan-2-yl)silyloxymethyl]cyclopent-2-en-1-one (CID 11308181) is (4S,5S)-4,5-dihydroxy-5-[tri(propan-2-yl)silyloxymethyl]cyclopent-2-en-1-one.
What is the SMILES notation for (4S,5S)-4,5-dihydroxy-5-[tri(propan-2-yl)silyloxymethyl]cyclopent-2-en-1-one?
The canonical SMILES for (4S,5S)-4,5-dihydroxy-5-[tri(propan-2-yl)silyloxymethyl]cyclopent-2-en-1-one is CC(C)[Si](OC[C@@]1(O)C(=O)C=C[C@@H]1O)(C(C)C)C(C)C.
What is the InChIKey of (4S,5S)-4,5-dihydroxy-5-[tri(propan-2-yl)silyloxymethyl]cyclopent-2-en-1-one?
The InChIKey is DJTANHVKXGAQHU-ZFWWWQNUSA-N. The full InChI is InChI=1S/C15H28O4Si/c1-10(2)20(11(3)4,12(5)6)19-9-15(18)13(16)7-8-14(15)17/h7-8,10-13,16,18H,9H2,1-6H3/t13-,15-/m0/s1.
What are the key properties of (4S,5S)-4,5-dihydroxy-5-[tri(propan-2-yl)silyloxymethyl]cyclopent-2-en-1-one?
(4S,5S)-4,5-dihydroxy-5-[tri(propan-2-yl)silyloxymethyl]cyclopent-2-en-1-one has a molecular weight of 300.47 g/mol, XLogP of 2.41, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4S,5S)-4,5-dihydroxy-5-[tri(propan-2-yl)silyloxymethyl]cyclopent-2-en-1-one is sourced from PubChem (CID 11308181), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).